C22H35N3O4 — CID 26742217
N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-methoxyethoxy)benzamide (PubChem CID 26742217) has the molecular formula C22H35N3O4 and a molecular weight of 405.54 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 26742217 |
| Molecular Formula | C22H35N3O4 |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.26 |
| IUPAC Name | N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)N[C@@H]2CN(C3CCN(C)CC3)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C22H35N3O4/c1-24-12-9-18(10-13-24)25-11-3-4-21(26)20(16-25)23-22(27)17-5-7-19(8-6-17)29-15-14-28-2/h5-8,18,20-21,26H,3-4,9-16H2,1-2H3,(H,23,27)/t20-,21-/m1/s1 |
| InChIKey | FGECBEWQRBMMQU-NHCUHLMSSA-N |
| XLogP | 1.36 |
| TPSA | 74.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|