C22H31N3O3 — CID 26742120
N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-prop-2-ynoxybenzamide (PubChem CID 26742120) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-prop-2-ynoxybenzamide.
| Compound Name | N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-prop-2-ynoxybenzamide |
|---|---|
| PubChem CID | 26742120 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | N-[(3R,4R)-4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-prop-2-ynoxybenzamide |
| SMILES | C#CCOc1ccc(C(=O)N[C@@H]2CN(C3CCN(C)CC3)CCC[C@H]2O)cc1 |
| InChI | InChI=1S/C22H31N3O3/c1-3-15-28-19-8-6-17(7-9-19)22(27)23-20-16-25(12-4-5-21(20)26)18-10-13-24(2)14-11-18/h1,6-9,18,20-21,26H,4-5,10-16H2,2H3,(H,23,27)/t20-,21-/m1/s1 |
| InChIKey | PGCHXSIZFNGNHB-NHCUHLMSSA-N |
| XLogP | 1.35 |
| TPSA | 65.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|