C25H40N4O4 — CID 74505316
N-[4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-morpholin-4-ylethoxy)benzamide (PubChem CID 74505316) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-morpholin-4-ylethoxy)benzamide.
| Compound Name | N-[4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-morpholin-4-ylethoxy)benzamide |
|---|---|
| PubChem CID | 74505316 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | N-[4-hydroxy-1-(1-methylpiperidin-4-yl)azepan-3-yl]-4-(2-morpholin-4-ylethoxy)benzamide |
| SMILES | CN1CCC(N2CCCC(O)C(NC(=O)c3ccc(OCCN4CCOCC4)cc3)C2)CC1 |
| InChI | InChI=1S/C25H40N4O4/c1-27-11-8-21(9-12-27)29-10-2-3-24(30)23(19-29)26-25(31)20-4-6-22(7-5-20)33-18-15-28-13-16-32-17-14-28/h4-7,21,23-24,30H,2-3,8-19H2,1H3,(H,26,31) |
| InChIKey | SZQYPLBIHSAIEY-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 77.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |