C24H30N2O2 — CID 29185356
[(3S)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(4-phenoxyphenyl)methanone (PubChem CID 29185356) has the molecular formula C24H30N2O2 and a molecular weight of 378.52 g/mol. Its IUPAC name is [(3S)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(4-phenoxyphenyl)methanone.
| Compound Name | [(3S)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(4-phenoxyphenyl)methanone |
|---|---|
| PubChem CID | 29185356 |
| Molecular Formula | C24H30N2O2 |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | [(3S)-1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(4-phenoxyphenyl)methanone |
| SMILES | CN1CCC(N2CCC[C@H](C(=O)c3ccc(Oc4ccccc4)cc3)C2)CC1 |
| InChI | InChI=1S/C24H30N2O2/c1-25-16-13-21(14-17-25)26-15-5-6-20(18-26)24(27)19-9-11-23(12-10-19)28-22-7-3-2-4-8-22/h2-4,7-12,20-21H,5-6,13-18H2,1H3/t20-/m0/s1 |
| InChIKey | YRCIMTLLYIXAQJ-FQEVSTJZSA-N |
| XLogP | 4.47 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |