C19H28N2OS — CID 45226774
[1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(2-methylsulfanylphenyl)methanone (PubChem CID 45226774) has the molecular formula C19H28N2OS and a molecular weight of 332.51 g/mol. Its IUPAC name is [1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(2-methylsulfanylphenyl)methanone.
| Compound Name | [1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(2-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 45226774 |
| Molecular Formula | C19H28N2OS |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | [1-(1-methylpiperidin-4-yl)piperidin-3-yl]-(2-methylsulfanylphenyl)methanone |
| SMILES | CSc1ccccc1C(=O)C1CCCN(C2CCN(C)CC2)C1 |
| InChI | InChI=1S/C19H28N2OS/c1-20-12-9-16(10-13-20)21-11-5-6-15(14-21)19(22)17-7-3-4-8-18(17)23-2/h3-4,7-8,15-16H,5-6,9-14H2,1-2H3 |
| InChIKey | OXKWGNVKKKORPQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |