C20H25NO2S — CID 25449567
[(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(2-methylsulfanylphenyl)methanone (PubChem CID 25449567) has the molecular formula C20H25NO2S and a molecular weight of 343.49 g/mol. Its IUPAC name is [(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(2-methylsulfanylphenyl)methanone.
| Compound Name | [(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(2-methylsulfanylphenyl)methanone |
|---|---|
| PubChem CID | 25449567 |
| Molecular Formula | C20H25NO2S |
| Molecular Weight | 343.49 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | [(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(2-methylsulfanylphenyl)methanone |
| SMILES | CCc1ccc(CN2CCC[C@H](C(=O)c3ccccc3SC)C2)o1 |
| InChI | InChI=1S/C20H25NO2S/c1-3-16-10-11-17(23-16)14-21-12-6-7-15(13-21)20(22)18-8-4-5-9-19(18)24-2/h4-5,8-11,15H,3,6-7,12-14H2,1-2H3/t15-/m0/s1 |
| InChIKey | ANLRGQGKOZSEMF-HNNXBMFYSA-N |
| XLogP | 4.66 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.49 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |