C18H23NO2S — CID 25381246
[(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(3-methylthiophen-2-yl)methanone (PubChem CID 25381246) has the molecular formula C18H23NO2S and a molecular weight of 317.45 g/mol. Its IUPAC name is [(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(3-methylthiophen-2-yl)methanone.
| Compound Name | [(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(3-methylthiophen-2-yl)methanone |
|---|---|
| PubChem CID | 25381246 |
| Molecular Formula | C18H23NO2S |
| Molecular Weight | 317.45 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | [(3S)-1-[(5-ethylfuran-2-yl)methyl]piperidin-3-yl]-(3-methylthiophen-2-yl)methanone |
| SMILES | CCc1ccc(CN2CCC[C@H](C(=O)c3sccc3C)C2)o1 |
| InChI | InChI=1S/C18H23NO2S/c1-3-15-6-7-16(21-15)12-19-9-4-5-14(11-19)17(20)18-13(2)8-10-22-18/h6-8,10,14H,3-5,9,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | YWVYTEFXPUIBGI-AWEZNQCLSA-N |
| XLogP | 4.31 |
| TPSA | 33.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.45 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |