C19H24N4O2S — CID 124852169
N-(1-methylpyrazol-3-yl)-2-[(3S)-3-(2-methylsulfanylbenzoyl)piperidin-1-yl]acetamide (PubChem CID 124852169) has the molecular formula C19H24N4O2S and a molecular weight of 372.49 g/mol. Its IUPAC name is N-(1-methylpyrazol-3-yl)-2-[(3S)-3-(2-methylsulfanylbenzoyl)piperidin-1-yl]acetamide.
| Compound Name | N-(1-methylpyrazol-3-yl)-2-[(3S)-3-(2-methylsulfanylbenzoyl)piperidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124852169 |
| Molecular Formula | C19H24N4O2S |
| Molecular Weight | 372.49 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | N-(1-methylpyrazol-3-yl)-2-[(3S)-3-(2-methylsulfanylbenzoyl)piperidin-1-yl]acetamide |
| SMILES | CSc1ccccc1C(=O)[C@H]1CCCN(CC(=O)Nc2ccn(C)n2)C1 |
| InChI | InChI=1S/C19H24N4O2S/c1-22-11-9-17(21-22)20-18(24)13-23-10-5-6-14(12-23)19(25)15-7-3-4-8-16(15)26-2/h3-4,7-9,11,14H,5-6,10,12-13H2,1-2H3,(H,20,21,24)/t14-/m0/s1 |
| InChIKey | UIHCXGAHTLAKSQ-AWEZNQCLSA-N |
| XLogP | 2.68 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.49 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |