C28H32N2O4 — CID 26741961
N-[(3R,4R)-4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]-4-phenylmethoxybenzamide (PubChem CID 26741961) has the molecular formula C28H32N2O4 and a molecular weight of 460.57 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]-4-phenylmethoxybenzamide.
| Compound Name | N-[(3R,4R)-4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]-4-phenylmethoxybenzamide |
|---|---|
| PubChem CID | 26741961 |
| Molecular Formula | C28H32N2O4 |
| Molecular Weight | 460.57 g/mol |
| Exact Mass | 460.24 |
| IUPAC Name | N-[(3R,4R)-4-hydroxy-1-[(3-methoxyphenyl)methyl]azepan-3-yl]-4-phenylmethoxybenzamide |
| SMILES | COc1cccc(CN2CCC[C@@H](O)[C@H](NC(=O)c3ccc(OCc4ccccc4)cc3)C2)c1 |
| InChI | InChI=1S/C28H32N2O4/c1-33-25-10-5-9-22(17-25)18-30-16-6-11-27(31)26(19-30)29-28(32)23-12-14-24(15-13-23)34-20-21-7-3-2-4-8-21/h2-5,7-10,12-15,17,26-27,31H,6,11,16,18-20H2,1H3,(H,29,32)/t26-,27-/m1/s1 |
| InChIKey | BRMDNTZMXCEQGM-KAYWLYCHSA-N |
| XLogP | 4.03 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |