C22H26FNO3 — CID 122101111
3-[1-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]piperidin-3-yl]propanoic acid (PubChem CID 122101111) has the molecular formula C22H26FNO3 and a molecular weight of 371.45 g/mol. Its IUPAC name is 3-[1-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]piperidin-3-yl]propanoic acid.
| Compound Name | 3-[1-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]piperidin-3-yl]propanoic acid |
|---|---|
| PubChem CID | 122101111 |
| Molecular Formula | C22H26FNO3 |
| Molecular Weight | 371.45 g/mol |
| Exact Mass | 371.19 |
| IUPAC Name | 3-[1-[[4-[(4-fluorophenyl)methoxy]phenyl]methyl]piperidin-3-yl]propanoic acid |
| SMILES | O=C(O)CCC1CCCN(Cc2ccc(OCc3ccc(F)cc3)cc2)C1 |
| InChI | InChI=1S/C22H26FNO3/c23-20-8-3-19(4-9-20)16-27-21-10-5-18(6-11-21)15-24-13-1-2-17(14-24)7-12-22(25)26/h3-6,8-11,17H,1-2,7,12-16H2,(H,25,26) |
| InChIKey | JZEFAUVSIDYFFE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.45 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |