C14H17NO2 — CID 98043423
(1S,5S)-9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-one (PubChem CID 98043423) has the molecular formula C14H17NO2 and a molecular weight of 231.30 g/mol. Its IUPAC name is (1S,5S)-9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-one.
| Compound Name | (1S,5S)-9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 98043423 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | (1S,5S)-9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-one |
| SMILES | O=C1C[C@H]2COC[C@H](C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C14H17NO2/c16-14-6-12-9-17-10-13(7-14)15(12)8-11-4-2-1-3-5-11/h1-5,12-13H,6-10H2/t12-,13-/m0/s1 |
| InChIKey | QNGMGMDGAYWQHD-STQMWFEESA-N |
| XLogP | 1.62 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |