C29H38N2O2 — CID 159859403
8-benzyl-8-azabicyclo[3.2.1]octan-3-one;8-benzyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 159859403) has the molecular formula C29H38N2O2 and a molecular weight of 446.64 g/mol. Its IUPAC name is 8-benzyl-8-azabicyclo[3.2.1]octan-3-one;8-benzyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | 8-benzyl-8-azabicyclo[3.2.1]octan-3-one;8-benzyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 159859403 |
| Molecular Formula | C29H38N2O2 |
| Molecular Weight | 446.64 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 8-benzyl-8-azabicyclo[3.2.1]octan-3-one;8-benzyl-3-methyl-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | CC1(O)CC2CCC(C1)N2Cc1ccccc1.O=C1CC2CCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C15H21NO.C14H17NO/c1-15(17)9-13-7-8-14(10-15)16(13)11-12-5-3-2-4-6-12;16-14-8-12-6-7-13(9-14)15(12)10-11-4-2-1-3-5-11/h2-6,13-14,17H,7-11H2,1H3;1-5,12-13H,6-10H2 |
| InChIKey | NQYCDJIWBIRQDO-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.64 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |