C13H19ClN2O — CID 68843951
9-benzyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane;hydrochloride (PubChem CID 68843951) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 9-benzyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane;hydrochloride.
| Compound Name | 9-benzyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane;hydrochloride |
|---|---|
| PubChem CID | 68843951 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 9-benzyl-3-oxa-7,9-diazabicyclo[3.3.1]nonane;hydrochloride |
| SMILES | Cl.c1ccc(CN2C3CNCC2COC3)cc1 |
| InChI | InChI=1S/C13H18N2O.ClH/c1-2-4-11(5-3-1)8-15-12-6-14-7-13(15)10-16-9-12;/h1-5,12-14H,6-10H2;1H |
| InChIKey | MFCRRPKKRRWDSL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |