C13H20N2O2 — CID 163511125
[(2S,6R)-1-benzyl-6-(hydroxymethyl)piperazin-2-yl]methanol (PubChem CID 163511125) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is [(2S,6R)-1-benzyl-6-(hydroxymethyl)piperazin-2-yl]methanol.
| Compound Name | [(2S,6R)-1-benzyl-6-(hydroxymethyl)piperazin-2-yl]methanol |
|---|---|
| PubChem CID | 163511125 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | [(2S,6R)-1-benzyl-6-(hydroxymethyl)piperazin-2-yl]methanol |
| SMILES | OC[C@@H]1CNC[C@H](CO)N1Cc1ccccc1 |
| InChI | InChI=1S/C13H20N2O2/c16-9-12-6-14-7-13(10-17)15(12)8-11-4-2-1-3-5-11/h1-5,12-14,16-17H,6-10H2/t12-,13+ |
| InChIKey | SHEVOATZXFMXFE-BETUJISGSA-N |
| XLogP | -0.19 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |