C14H22N2O2 — CID 163246293
(2R,6S)-1-benzyl-2-(2-hydroxyethyl)-1,4-diazepan-6-ol (PubChem CID 163246293) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (2R,6S)-1-benzyl-2-(2-hydroxyethyl)-1,4-diazepan-6-ol.
| Compound Name | (2R,6S)-1-benzyl-2-(2-hydroxyethyl)-1,4-diazepan-6-ol |
|---|---|
| PubChem CID | 163246293 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (2R,6S)-1-benzyl-2-(2-hydroxyethyl)-1,4-diazepan-6-ol |
| SMILES | OCC[C@@H]1CNC[C@H](O)CN1Cc1ccccc1 |
| InChI | InChI=1S/C14H22N2O2/c17-7-6-13-8-15-9-14(18)11-16(13)10-12-4-2-1-3-5-12/h1-5,13-15,17-18H,6-11H2/t13-,14+/m1/s1 |
| InChIKey | LNULWXRGRLEDJD-KGLIPLIRSA-N |
| XLogP | 0.20 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |