C23H28N4O — CID 92764868
2-[(2R)-1-benzyl-4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 92764868) has the molecular formula C23H28N4O and a molecular weight of 376.50 g/mol. Its IUPAC name is 2-[(2R)-1-benzyl-4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[(2R)-1-benzyl-4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 92764868 |
| Molecular Formula | C23H28N4O |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-[(2R)-1-benzyl-4-[(4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | OCC[C@@H]1CN(Cc2ccc(-n3cccn3)cc2)CCN1Cc1ccccc1 |
| InChI | InChI=1S/C23H28N4O/c28-16-11-23-19-25(14-15-26(23)18-20-5-2-1-3-6-20)17-21-7-9-22(10-8-21)27-13-4-12-24-27/h1-10,12-13,23,28H,11,14-19H2/t23-/m1/s1 |
| InChIKey | YSKAMAVCVYBNCF-HSZRJFAPSA-N |
| XLogP | 2.94 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |