C22H32N4O — CID 45244168
2-[1-(3-methylbut-2-enyl)-4-[(2-methyl-4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol (PubChem CID 45244168) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-[1-(3-methylbut-2-enyl)-4-[(2-methyl-4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol.
| Compound Name | 2-[1-(3-methylbut-2-enyl)-4-[(2-methyl-4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 45244168 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2-[1-(3-methylbut-2-enyl)-4-[(2-methyl-4-pyrazol-1-ylphenyl)methyl]piperazin-2-yl]ethanol |
| SMILES | CC(C)=CCN1CCN(Cc2ccc(-n3cccn3)cc2C)CC1CCO |
| InChI | InChI=1S/C22H32N4O/c1-18(2)7-11-25-13-12-24(17-22(25)8-14-27)16-20-5-6-21(15-19(20)3)26-10-4-9-23-26/h4-7,9-10,15,22,27H,8,11-14,16-17H2,1-3H3 |
| InChIKey | YEGJAFLGHWRMGH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|