C18H26F2N2O — CID 29029362
2-[(2S)-4-[(3,5-difluorophenyl)methyl]-1-(3-methylbut-2-enyl)piperazin-2-yl]ethanol (PubChem CID 29029362) has the molecular formula C18H26F2N2O and a molecular weight of 324.42 g/mol. Its IUPAC name is 2-[(2S)-4-[(3,5-difluorophenyl)methyl]-1-(3-methylbut-2-enyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[(2S)-4-[(3,5-difluorophenyl)methyl]-1-(3-methylbut-2-enyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 29029362 |
| Molecular Formula | C18H26F2N2O |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | 2-[(2S)-4-[(3,5-difluorophenyl)methyl]-1-(3-methylbut-2-enyl)piperazin-2-yl]ethanol |
| SMILES | CC(C)=CCN1CCN(Cc2cc(F)cc(F)c2)C[C@@H]1CCO |
| InChI | InChI=1S/C18H26F2N2O/c1-14(2)3-5-22-7-6-21(13-18(22)4-8-23)12-15-9-16(19)11-17(20)10-15/h3,9-11,18,23H,4-8,12-13H2,1-2H3/t18-/m0/s1 |
| InChIKey | QDHNHOMGQAWQBA-SFHVURJKSA-N |
| XLogP | 2.80 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|