C25H31FN4O — CID 56855840
2-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol (PubChem CID 56855840) has the molecular formula C25H31FN4O and a molecular weight of 422.55 g/mol. Its IUPAC name is 2-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol.
| Compound Name | 2-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol |
|---|---|
| PubChem CID | 56855840 |
| Molecular Formula | C25H31FN4O |
| Molecular Weight | 422.55 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 2-[4-[[1-(4-fluorophenyl)pyrazol-4-yl]methyl]-1-(3-phenylpropyl)piperazin-2-yl]ethanol |
| SMILES | OCCC1CN(Cc2cnn(-c3ccc(F)cc3)c2)CCN1CCCc1ccccc1 |
| InChI | InChI=1S/C25H31FN4O/c26-23-8-10-24(11-9-23)30-19-22(17-27-30)18-28-14-15-29(25(20-28)12-16-31)13-4-7-21-5-2-1-3-6-21/h1-3,5-6,8-11,17,19,25,31H,4,7,12-16,18,20H2 |
| InChIKey | UFNAHFFOGUDETG-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |