C14H21NO2 — CID 59404485
[(2R,6S)-1-benzyl-6-(hydroxymethyl)piperidin-2-yl](113C)methanol (PubChem CID 59404485) has the molecular formula C14H21NO2 and a molecular weight of 236.32 g/mol. Its IUPAC name is [(2R,6S)-1-benzyl-6-(hydroxymethyl)piperidin-2-yl](113C)methanol.
| Compound Name | [(2R,6S)-1-benzyl-6-(hydroxymethyl)piperidin-2-yl](113C)methanol |
|---|---|
| PubChem CID | 59404485 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | [(2R,6S)-1-benzyl-6-(hydroxymethyl)piperidin-2-yl](113C)methanol |
| SMILES | OC[C@@H]1CCC[C@H]([13CH2]O)N1Cc1ccccc1 |
| InChI | InChI=1S/C14H21NO2/c16-10-13-7-4-8-14(11-17)15(13)9-12-5-2-1-3-6-12/h1-3,5-6,13-14,16-17H,4,7-11H2/t13-,14+/i10+1/m1/s1 |
| InChIKey | ZYCSKJLOQJGMCL-TUOPLANQSA-N |
| XLogP | 1.39 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |