C15H22Cl3N — CID 11971663
1-benzyl-2,7-bis(chloromethyl)azepane;hydrochloride (PubChem CID 11971663) has the molecular formula C15H22Cl3N and a molecular weight of 322.71 g/mol. Its IUPAC name is 1-benzyl-2,7-bis(chloromethyl)azepane;hydrochloride.
| Compound Name | 1-benzyl-2,7-bis(chloromethyl)azepane;hydrochloride |
|---|---|
| PubChem CID | 11971663 |
| Molecular Formula | C15H22Cl3N |
| Molecular Weight | 322.71 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 1-benzyl-2,7-bis(chloromethyl)azepane;hydrochloride |
| SMILES | Cl.ClCC1CCCCC(CCl)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H21Cl2N.ClH/c16-10-14-8-4-5-9-15(11-17)18(14)12-13-6-2-1-3-7-13;/h1-3,6-7,14-15H,4-5,8-12H2;1H |
| InChIKey | YGTNVRSMNMHBEE-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.71 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|