C17H21NO3 — CID 171951560
methyl 2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene)acetate (PubChem CID 171951560) has the molecular formula C17H21NO3 and a molecular weight of 287.36 g/mol. Its IUPAC name is methyl 2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene)acetate.
| Compound Name | methyl 2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene)acetate |
|---|---|
| PubChem CID | 171951560 |
| Molecular Formula | C17H21NO3 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | methyl 2-(9-benzyl-3-oxa-9-azabicyclo[3.3.1]nonan-7-ylidene)acetate |
| SMILES | COC(=O)C=C1CC2COCC(C1)N2Cc1ccccc1 |
| InChI | InChI=1S/C17H21NO3/c1-20-17(19)9-14-7-15-11-21-12-16(8-14)18(15)10-13-5-3-2-4-6-13/h2-6,9,15-16H,7-8,10-12H2,1H3 |
| InChIKey | LTRVHSSFCDHKLY-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|