C18H25NO3 — CID 102406016
(2-benzyl-3-cyclohexyl-1,2-oxazolidin-5-yl) acetate (PubChem CID 102406016) has the molecular formula C18H25NO3 and a molecular weight of 303.40 g/mol. Its IUPAC name is (2-benzyl-3-cyclohexyl-1,2-oxazolidin-5-yl) acetate.
| Compound Name | (2-benzyl-3-cyclohexyl-1,2-oxazolidin-5-yl) acetate |
|---|---|
| PubChem CID | 102406016 |
| Molecular Formula | C18H25NO3 |
| Molecular Weight | 303.40 g/mol |
| Exact Mass | 303.18 |
| IUPAC Name | (2-benzyl-3-cyclohexyl-1,2-oxazolidin-5-yl) acetate |
| SMILES | CC(=O)OC1CC(C2CCCCC2)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C18H25NO3/c1-14(20)21-18-12-17(16-10-6-3-7-11-16)19(22-18)13-15-8-4-2-5-9-15/h2,4-5,8-9,16-18H,3,6-7,10-13H2,1H3 |
| InChIKey | MHVXQHCYKXEOJG-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.40 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |