C18H23NO3 — CID 134332338
benzyl (2S,3aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 134332338) has the molecular formula C18H23NO3 and a molecular weight of 301.39 g/mol. Its IUPAC name is benzyl (2S,3aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | benzyl (2S,3aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 134332338 |
| Molecular Formula | C18H23NO3 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.17 |
| IUPAC Name | benzyl (2S,3aS)-1-acetyl-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | CC(=O)N1C2CCCC[C@H]2C[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H23NO3/c1-13(20)19-16-10-6-5-9-15(16)11-17(19)18(21)22-12-14-7-3-2-4-8-14/h2-4,7-8,15-17H,5-6,9-12H2,1H3/t15-,16?,17-/m0/s1 |
| InChIKey | HKTOONQWXSTTBT-QRFGZVGRSA-N |
| XLogP | 2.91 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |