C20H24F3NO6S — CID 88698759
benzyl (2S,3aR,7aS)-1-[(2R)-2-(trifluoromethylsulfonyloxy)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate (PubChem CID 88698759) has the molecular formula C20H24F3NO6S and a molecular weight of 463.47 g/mol. Its IUPAC name is benzyl (2S,3aR,7aS)-1-[(2R)-2-(trifluoromethylsulfonyloxy)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate.
| Compound Name | benzyl (2S,3aR,7aS)-1-[(2R)-2-(trifluoromethylsulfonyloxy)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
|---|---|
| PubChem CID | 88698759 |
| Molecular Formula | C20H24F3NO6S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | benzyl (2S,3aR,7aS)-1-[(2R)-2-(trifluoromethylsulfonyloxy)propanoyl]-2,3,3a,4,5,6,7,7a-octahydroindole-2-carboxylate |
| SMILES | C[C@@H](OS(=O)(=O)C(F)(F)F)C(=O)N1[C@H](C(=O)OCc2ccccc2)C[C@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C20H24F3NO6S/c1-13(30-31(27,28)20(21,22)23)18(25)24-16-10-6-5-9-15(16)11-17(24)19(26)29-12-14-7-3-2-4-8-14/h2-4,7-8,13,15-17H,5-6,9-12H2,1H3/t13-,15-,16+,17+/m1/s1 |
| InChIKey | OZXQMGOAPBMNKC-SIXLDLHFSA-N |
| XLogP | 3.14 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|