C20H24F3NO7S — CID 88711139
[3-[(2S,3aR,7aR)-2-phenylmethoxycarbonyloxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-oxopropyl] trifluoromethanesulfonate (PubChem CID 88711139) has the molecular formula C20H24F3NO7S and a molecular weight of 479.47 g/mol. Its IUPAC name is [3-[(2S,3aR,7aR)-2-phenylmethoxycarbonyloxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-oxopropyl] trifluoromethanesulfonate.
| Compound Name | [3-[(2S,3aR,7aR)-2-phenylmethoxycarbonyloxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-oxopropyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 88711139 |
| Molecular Formula | C20H24F3NO7S |
| Molecular Weight | 479.47 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | [3-[(2S,3aR,7aR)-2-phenylmethoxycarbonyloxy-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-oxopropyl] trifluoromethanesulfonate |
| SMILES | O=C(OCc1ccccc1)O[C@H]1C[C@H]2CCCC[C@H]2N1C(=O)CCOS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C20H24F3NO7S/c21-20(22,23)32(27,28)30-11-10-17(25)24-16-9-5-4-8-15(16)12-18(24)31-19(26)29-13-14-6-2-1-3-7-14/h1-3,6-7,15-16,18H,4-5,8-13H2/t15-,16-,18+/m1/s1 |
| InChIKey | TXUUBOGZVRAPES-NUJGCVRESA-N |
| XLogP | 3.71 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.47 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|