C21H24N2O — CID 102209940
(4aS,7aS)-1,3-dibenzyl-4,4a,5,6,7,7a-hexahydrocyclopenta[d]pyrimidin-2-one (PubChem CID 102209940) has the molecular formula C21H24N2O and a molecular weight of 320.44 g/mol. Its IUPAC name is (4aS,7aS)-1,3-dibenzyl-4,4a,5,6,7,7a-hexahydrocyclopenta[d]pyrimidin-2-one.
| Compound Name | (4aS,7aS)-1,3-dibenzyl-4,4a,5,6,7,7a-hexahydrocyclopenta[d]pyrimidin-2-one |
|---|---|
| PubChem CID | 102209940 |
| Molecular Formula | C21H24N2O |
| Molecular Weight | 320.44 g/mol |
| Exact Mass | 320.19 |
| IUPAC Name | (4aS,7aS)-1,3-dibenzyl-4,4a,5,6,7,7a-hexahydrocyclopenta[d]pyrimidin-2-one |
| SMILES | O=C1N(Cc2ccccc2)C[C@@H]2CCC[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C21H24N2O/c24-21-22(14-17-8-3-1-4-9-17)16-19-12-7-13-20(19)23(21)15-18-10-5-2-6-11-18/h1-6,8-11,19-20H,7,12-16H2/t19-,20-/m0/s1 |
| InChIKey | ZDEUCHQHQVENJW-PMACEKPBSA-N |
| XLogP | 4.29 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.44 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |