C20H23N3O3S — CID 171144556
1-benzyl-7-pyridin-3-ylsulfonyl-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one (PubChem CID 171144556) has the molecular formula C20H23N3O3S and a molecular weight of 385.49 g/mol. Its IUPAC name is 1-benzyl-7-pyridin-3-ylsulfonyl-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one.
| Compound Name | 1-benzyl-7-pyridin-3-ylsulfonyl-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one |
|---|---|
| PubChem CID | 171144556 |
| Molecular Formula | C20H23N3O3S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 1-benzyl-7-pyridin-3-ylsulfonyl-4,5,5a,6,8,8a-hexahydro-3H-pyrrolo[3,4-b]azepin-2-one |
| SMILES | O=C1CCCC2CN(S(=O)(=O)c3cccnc3)CC2N1Cc1ccccc1 |
| InChI | InChI=1S/C20H23N3O3S/c24-20-10-4-8-17-14-22(27(25,26)18-9-5-11-21-12-18)15-19(17)23(20)13-16-6-2-1-3-7-16/h1-3,5-7,9,11-12,17,19H,4,8,10,13-15H2 |
| InChIKey | JKTVMUPDYXEYHE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |