C18H27N3O — CID 126466664
(4aR,8aS)-6-(2-methylpropyl)-1-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 126466664) has the molecular formula C18H27N3O and a molecular weight of 301.43 g/mol. Its IUPAC name is (4aR,8aS)-6-(2-methylpropyl)-1-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aR,8aS)-6-(2-methylpropyl)-1-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 126466664 |
| Molecular Formula | C18H27N3O |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.22 |
| IUPAC Name | (4aR,8aS)-6-(2-methylpropyl)-1-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CC(C)CN1CC[C@H]2[C@H](CCC(=O)N2Cc2cccnc2)C1 |
| InChI | InChI=1S/C18H27N3O/c1-14(2)11-20-9-7-17-16(13-20)5-6-18(22)21(17)12-15-4-3-8-19-10-15/h3-4,8,10,14,16-17H,5-7,9,11-13H2,1-2H3/t16-,17+/m1/s1 |
| InChIKey | FUUCSDPEIBWZRS-SJORKVTESA-N |
| XLogP | 2.55 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |