C19H30N4O — CID 133116816
(4aS,8aR)-1-[3-(dimethylamino)propyl]-6-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 133116816) has the molecular formula C19H30N4O and a molecular weight of 330.48 g/mol. Its IUPAC name is (4aS,8aR)-1-[3-(dimethylamino)propyl]-6-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-[3-(dimethylamino)propyl]-6-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 133116816 |
| Molecular Formula | C19H30N4O |
| Molecular Weight | 330.48 g/mol |
| Exact Mass | 330.24 |
| IUPAC Name | (4aS,8aR)-1-[3-(dimethylamino)propyl]-6-(pyridin-3-ylmethyl)-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | CN(C)CCCN1C(=O)CC[C@H]2CN(Cc3cccnc3)CC[C@H]21 |
| InChI | InChI=1S/C19H30N4O/c1-21(2)10-4-11-23-18-8-12-22(14-16-5-3-9-20-13-16)15-17(18)6-7-19(23)24/h3,5,9,13,17-18H,4,6-8,10-12,14-15H2,1-2H3/t17-,18+/m0/s1 |
| InChIKey | BDXWITKYJZRJKT-ZWKOTPCHSA-N |
| XLogP | 1.85 |
| TPSA | 39.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.48 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |