C21H29N5O — CID 70758891
(4aS,8aR)-1-(3-imidazol-1-ylpropyl)-6-[(6-methyl-2-pyridinyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one (PubChem CID 70758891) has the molecular formula C21H29N5O and a molecular weight of 367.50 g/mol. Its IUPAC name is (4aS,8aR)-1-(3-imidazol-1-ylpropyl)-6-[(6-methyl-2-pyridinyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one.
| Compound Name | (4aS,8aR)-1-(3-imidazol-1-ylpropyl)-6-[(6-methyl-2-pyridinyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
|---|---|
| PubChem CID | 70758891 |
| Molecular Formula | C21H29N5O |
| Molecular Weight | 367.50 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (4aS,8aR)-1-(3-imidazol-1-ylpropyl)-6-[(6-methyl-2-pyridinyl)methyl]-4,4a,5,7,8,8a-hexahydro-3H-1,6-naphthyridin-2-one |
| SMILES | Cc1cccc(CN2CC[C@@H]3[C@@H](CCC(=O)N3CCCn3ccnc3)C2)n1 |
| InChI | InChI=1S/C21H29N5O/c1-17-4-2-5-19(23-17)15-25-12-8-20-18(14-25)6-7-21(27)26(20)11-3-10-24-13-9-22-16-24/h2,4-5,9,13,16,18,20H,3,6-8,10-12,14-15H2,1H3/t18-,20+/m0/s1 |
| InChIKey | NPJLPPFPCPMYAJ-AZUAARDMSA-N |
| XLogP | 2.49 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |