C23H30N3+ — CID 10596155
[(3aS,7aS)-1,3-dibenzyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-ylidene]-dimethylazanium (PubChem CID 10596155) has the molecular formula C23H30N3+ and a molecular weight of 348.51 g/mol. Its IUPAC name is [(3aS,7aS)-1,3-dibenzyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-ylidene]-dimethylazanium.
| Compound Name | [(3aS,7aS)-1,3-dibenzyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-ylidene]-dimethylazanium |
|---|---|
| PubChem CID | 10596155 |
| Molecular Formula | C23H30N3+ |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | [(3aS,7aS)-1,3-dibenzyl-3a,4,5,6,7,7a-hexahydrobenzimidazol-2-ylidene]-dimethylazanium |
| SMILES | C[N+](C)=C1N(Cc2ccccc2)[C@H]2CCCC[C@@H]2N1Cc1ccccc1 |
| InChI | InChI=1S/C23H30N3/c1-24(2)23-25(17-19-11-5-3-6-12-19)21-15-9-10-16-22(21)26(23)18-20-13-7-4-8-14-20/h3-8,11-14,21-22H,9-10,15-18H2,1-2H3/q+1/t21-,22-/m0/s1 |
| InChIKey | OCTPLZABCBEYGI-VXKWHMMOSA-N |
| XLogP | 3.94 |
| TPSA | 9.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|