C14H19NO — CID 124709041
(5R,6S)-1-benzyl-5,6-dimethylpiperidin-3-one (PubChem CID 124709041) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (5R,6S)-1-benzyl-5,6-dimethylpiperidin-3-one.
| Compound Name | (5R,6S)-1-benzyl-5,6-dimethylpiperidin-3-one |
|---|---|
| PubChem CID | 124709041 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (5R,6S)-1-benzyl-5,6-dimethylpiperidin-3-one |
| SMILES | C[C@@H]1CC(=O)CN(Cc2ccccc2)[C@H]1C |
| InChI | InChI=1S/C14H19NO/c1-11-8-14(16)10-15(12(11)2)9-13-6-4-3-5-7-13/h3-7,11-12H,8-10H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | GBNPXKCPQPNLBB-NEPJUHHUSA-N |
| XLogP | 2.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |