C14H20ClNO — CID 53444394
1-benzyl-2,3-dimethylpiperidin-4-one;hydrochloride (PubChem CID 53444394) has the molecular formula C14H20ClNO and a molecular weight of 253.77 g/mol. Its IUPAC name is 1-benzyl-2,3-dimethylpiperidin-4-one;hydrochloride.
| Compound Name | 1-benzyl-2,3-dimethylpiperidin-4-one;hydrochloride |
|---|---|
| PubChem CID | 53444394 |
| Molecular Formula | C14H20ClNO |
| Molecular Weight | 253.77 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | 1-benzyl-2,3-dimethylpiperidin-4-one;hydrochloride |
| SMILES | CC1C(=O)CCN(Cc2ccccc2)C1C.Cl |
| InChI | InChI=1S/C14H19NO.ClH/c1-11-12(2)15(9-8-14(11)16)10-13-6-4-3-5-7-13;/h3-7,11-12H,8-10H2,1-2H3;1H |
| InChIKey | QJBLUCMAWLXXEV-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.77 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |