C14H18ClNO — CID 79406157
1-[(3-chlorophenyl)methyl]-2,3-dimethylpiperidin-4-one (PubChem CID 79406157) has the molecular formula C14H18ClNO and a molecular weight of 251.76 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2,3-dimethylpiperidin-4-one.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2,3-dimethylpiperidin-4-one |
|---|---|
| PubChem CID | 79406157 |
| Molecular Formula | C14H18ClNO |
| Molecular Weight | 251.76 g/mol |
| Exact Mass | 251.11 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2,3-dimethylpiperidin-4-one |
| SMILES | CC1C(=O)CCN(Cc2cccc(Cl)c2)C1C |
| InChI | InChI=1S/C14H18ClNO/c1-10-11(2)16(7-6-14(10)17)9-12-4-3-5-13(15)8-12/h3-5,8,10-11H,6-7,9H2,1-2H3 |
| InChIKey | JOOXLFPEWFUKJE-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.76 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |