C16H23NOSi — CID 11086946
1-benzyl-2-methyl-5-trimethylsilyl-2,6-dihydropyridin-3-one (PubChem CID 11086946) has the molecular formula C16H23NOSi and a molecular weight of 273.45 g/mol. Its IUPAC name is 1-benzyl-2-methyl-5-trimethylsilyl-2,6-dihydropyridin-3-one.
| Compound Name | 1-benzyl-2-methyl-5-trimethylsilyl-2,6-dihydropyridin-3-one |
|---|---|
| PubChem CID | 11086946 |
| Molecular Formula | C16H23NOSi |
| Molecular Weight | 273.45 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | 1-benzyl-2-methyl-5-trimethylsilyl-2,6-dihydropyridin-3-one |
| SMILES | CC1C(=O)C=C([Si](C)(C)C)CN1Cc1ccccc1 |
| InChI | InChI=1S/C16H23NOSi/c1-13-16(18)10-15(19(2,3)4)12-17(13)11-14-8-6-5-7-9-14/h5-10,13H,11-12H2,1-4H3 |
| InChIKey | UUGSXDMBXBHIHS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|