C12H13NO2 — CID 158048514
(4R)-4-benzyl-3-methyl-2-methylidene-1,3-oxazolidin-5-one (PubChem CID 158048514) has the molecular formula C12H13NO2 and a molecular weight of 203.24 g/mol. Its IUPAC name is (4R)-4-benzyl-3-methyl-2-methylidene-1,3-oxazolidin-5-one.
| Compound Name | (4R)-4-benzyl-3-methyl-2-methylidene-1,3-oxazolidin-5-one |
|---|---|
| PubChem CID | 158048514 |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | (4R)-4-benzyl-3-methyl-2-methylidene-1,3-oxazolidin-5-one |
| SMILES | C=C1OC(=O)[C@@H](Cc2ccccc2)N1C |
| InChI | InChI=1S/C12H13NO2/c1-9-13(2)11(12(14)15-9)8-10-6-4-3-5-7-10/h3-7,11H,1,8H2,2H3/t11-/m1/s1 |
| InChIKey | WLTGBVORXSMYBA-LLVKDONJSA-N |
| XLogP | 1.56 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |