C17H16N2O3 — CID 101385697
5-benzyl-2-methyl-4-phenyl-1,2,5-oxadiazinane-3,6-dione (PubChem CID 101385697) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 5-benzyl-2-methyl-4-phenyl-1,2,5-oxadiazinane-3,6-dione.
| Compound Name | 5-benzyl-2-methyl-4-phenyl-1,2,5-oxadiazinane-3,6-dione |
|---|---|
| PubChem CID | 101385697 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5-benzyl-2-methyl-4-phenyl-1,2,5-oxadiazinane-3,6-dione |
| SMILES | CN1OC(=O)N(Cc2ccccc2)C(c2ccccc2)C1=O |
| InChI | InChI=1S/C17H16N2O3/c1-18-16(20)15(14-10-6-3-7-11-14)19(17(21)22-18)12-13-8-4-2-5-9-13/h2-11,15H,12H2,1H3 |
| InChIKey | FVNOISFYVKROKI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |