About 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one
3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one (PubChem CID 13045968) has the molecular formula C15H12N2O2S
and a molecular weight of 284.34 g/mol. Its IUPAC name is 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one.
Molecular Properties
| Compound Name | 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| PubChem CID | 13045968 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one |
| SMILES | NN1C(=O)C(c2ccccc2)(c2ccccc2)OC1=S |
| InChI | InChI=1S/C15H12N2O2S/c16-17-13(18)15(19-14(17)20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,16H2 |
| InChIKey | VCJUCHYFLAIDIN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
The IUPAC name of 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one (CID 13045968) is 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one.
What is the SMILES notation for 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
The canonical SMILES for 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one is NN1C(=O)C(c2ccccc2)(c2ccccc2)OC1=S.
What is the InChIKey of 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
The InChIKey is VCJUCHYFLAIDIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12N2O2S/c16-17-13(18)15(19-14(17)20,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,16H2.
What are the key properties of 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one?
3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one has a molecular weight of 284.34 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5,5-diphenyl-2-sulfanylidene-1,3-oxazolidin-4-one is sourced from PubChem (CID 13045968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).