C16H10I2O2 — CID 139257538
3,4-diiodo-5,5-diphenylfuran-2-one (PubChem CID 139257538) has the molecular formula C16H10I2O2 and a molecular weight of 488.06 g/mol. Its IUPAC name is 3,4-diiodo-5,5-diphenylfuran-2-one.
| Compound Name | 3,4-diiodo-5,5-diphenylfuran-2-one |
|---|---|
| PubChem CID | 139257538 |
| Molecular Formula | C16H10I2O2 |
| Molecular Weight | 488.06 g/mol |
| Exact Mass | 487.88 |
| IUPAC Name | 3,4-diiodo-5,5-diphenylfuran-2-one |
| SMILES | O=C1OC(c2ccccc2)(c2ccccc2)C(I)=C1I |
| InChI | InChI=1S/C16H10I2O2/c17-13-14(18)16(20-15(13)19,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H |
| InChIKey | BMMMYDURRWTLJS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.06 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|