C22H16O4 — CID 139914960
(5S)-3,4-dihydroxy-5-phenyl-5-(4-phenylphenyl)furan-2-one (PubChem CID 139914960) has the molecular formula C22H16O4 and a molecular weight of 344.37 g/mol. Its IUPAC name is (5S)-3,4-dihydroxy-5-phenyl-5-(4-phenylphenyl)furan-2-one.
| Compound Name | (5S)-3,4-dihydroxy-5-phenyl-5-(4-phenylphenyl)furan-2-one |
|---|---|
| PubChem CID | 139914960 |
| Molecular Formula | C22H16O4 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.10 |
| IUPAC Name | (5S)-3,4-dihydroxy-5-phenyl-5-(4-phenylphenyl)furan-2-one |
| SMILES | O=C1O[C@@](c2ccccc2)(c2ccc(-c3ccccc3)cc2)C(O)=C1O |
| InChI | InChI=1S/C22H16O4/c23-19-20(24)22(26-21(19)25,17-9-5-2-6-10-17)18-13-11-16(12-14-18)15-7-3-1-4-8-15/h1-14,23-24H/t22-/m0/s1 |
| InChIKey | QBMNZEUSOGEWNK-QFIPXVFZSA-N |
| XLogP | 4.48 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |