C32H22O4 — CID 54054786
3-(4-hydroxy-3,5-diphenylphenyl)-3-(4-hydroxyphenyl)-2-benzofuran-1-one (PubChem CID 54054786) has the molecular formula C32H22O4 and a molecular weight of 470.52 g/mol. Its IUPAC name is 3-(4-hydroxy-3,5-diphenylphenyl)-3-(4-hydroxyphenyl)-2-benzofuran-1-one.
| Compound Name | 3-(4-hydroxy-3,5-diphenylphenyl)-3-(4-hydroxyphenyl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 54054786 |
| Molecular Formula | C32H22O4 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | 3-(4-hydroxy-3,5-diphenylphenyl)-3-(4-hydroxyphenyl)-2-benzofuran-1-one |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2cc(-c3ccccc3)c(O)c(-c3ccccc3)c2)c2ccccc21 |
| InChI | InChI=1S/C32H22O4/c33-25-17-15-23(16-18-25)32(29-14-8-7-13-26(29)31(35)36-32)24-19-27(21-9-3-1-4-10-21)30(34)28(20-24)22-11-5-2-6-12-22/h1-20,33-34H |
| InChIKey | LVMCMMOPNZZVLM-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |