About 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione
5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione (PubChem CID 3089393) has the molecular formula C24H10O8
and a molecular weight of 426.34 g/mol. Its IUPAC name is 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione.
Molecular Properties
| Compound Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione |
| PubChem CID | 3089393 |
| Molecular Formula | C24H10O8 |
| Molecular Weight | 426.34 g/mol |
| Exact Mass | 426.04 |
| IUPAC Name | 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione |
| SMILES | O=C1OC(=O)c2cc(C3(c4ccc5c(c4)C(=O)OC5=O)OC(=O)c4ccccc43)ccc21 |
| InChI | InChI=1S/C24H10O8/c25-19-13-7-5-11(9-16(13)21(27)30-19)24(18-4-2-1-3-15(18)23(29)32-24)12-6-8-14-17(10-12)22(28)31-20(14)26/h1-10H |
| InChIKey | AMVDILNJGDGKFU-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 113.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 426.34 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione?
The IUPAC name of 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione (CID 3089393) is 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione.
What is the SMILES notation for 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione?
The canonical SMILES for 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione is O=C1OC(=O)c2cc(C3(c4ccc5c(c4)C(=O)OC5=O)OC(=O)c4ccccc43)ccc21.
What is the InChIKey of 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione?
The InChIKey is AMVDILNJGDGKFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H10O8/c25-19-13-7-5-11(9-16(13)21(27)30-19)24(18-4-2-1-3-15(18)23(29)32-24)12-6-8-14-17(10-12)22(28)31-20(14)26/h1-10H.
What are the key properties of 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione?
5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione has a molecular weight of 426.34 g/mol, XLogP of 2.77, 2 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[1-(1,3-dioxo-2-benzofuran-5-yl)-3-oxo-2-benzofuran-1-yl]-2-benzofuran-1,3-dione is sourced from PubChem (CID 3089393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).