C24H22O4 — CID 138632201
3,3-bis[3-(methoxymethyl)phenyl]-2-benzofuran-1-one (PubChem CID 138632201) has the molecular formula C24H22O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3,3-bis[3-(methoxymethyl)phenyl]-2-benzofuran-1-one.
| Compound Name | 3,3-bis[3-(methoxymethyl)phenyl]-2-benzofuran-1-one |
|---|---|
| PubChem CID | 138632201 |
| Molecular Formula | C24H22O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 3,3-bis[3-(methoxymethyl)phenyl]-2-benzofuran-1-one |
| SMILES | COCc1cccc(C2(c3cccc(COC)c3)OC(=O)c3ccccc32)c1 |
| InChI | InChI=1S/C24H22O4/c1-26-15-17-7-5-9-19(13-17)24(20-10-6-8-18(14-20)16-27-2)22-12-4-3-11-21(22)23(25)28-24/h3-14H,15-16H2,1-2H3 |
| InChIKey | SNWICFFKCQFIQB-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |