C32H26O10S2 — CID 19733526
benzenesulfonic acid;3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one (PubChem CID 19733526) has the molecular formula C32H26O10S2 and a molecular weight of 634.68 g/mol. Its IUPAC name is benzenesulfonic acid;3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one.
| Compound Name | benzenesulfonic acid;3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 19733526 |
| Molecular Formula | C32H26O10S2 |
| Molecular Weight | 634.68 g/mol |
| Exact Mass | 634.10 |
| IUPAC Name | benzenesulfonic acid;3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21.O=S(=O)(O)c1ccccc1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C20H14O4.2C6H6O3S/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20;2*7-10(8,9)6-4-2-1-3-5-6/h1-12,21-22H;2*1-5H,(H,7,8,9) |
| InChIKey | VVMUJXHTMOARAH-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 175.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.68 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|