About 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol
3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol (PubChem CID 160841492) has the molecular formula C32H22O8
and a molecular weight of 534.52 g/mol. Its IUPAC name is 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol.
Molecular Properties
| Compound Name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol |
| PubChem CID | 160841492 |
| Molecular Formula | C32H22O8 |
| Molecular Weight | 534.52 g/mol |
| Exact Mass | 534.13 |
| IUPAC Name | 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol |
| SMILES | O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21.Oc1ccc2c(c1)Oc1cccc(O)c1O2 |
| InChI | InChI=1S/C20H14O4.C12H8O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20;13-7-4-5-9-11(6-7)15-10-3-1-2-8(14)12(10)16-9/h1-12,21-22H;1-6,13-14H |
| InChIKey | SICBHOJEFCAOKF-UHFFFAOYSA-N |
| XLogP | 6.56 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.52 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol?
The IUPAC name of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol (CID 160841492) is 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol.
What is the SMILES notation for 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol?
The canonical SMILES for 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol is O=C1OC(c2ccc(O)cc2)(c2ccc(O)cc2)c2ccccc21.Oc1ccc2c(c1)Oc1cccc(O)c1O2.
What is the InChIKey of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol?
The InChIKey is SICBHOJEFCAOKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H14O4.C12H8O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20;13-7-4-5-9-11(6-7)15-10-3-1-2-8(14)12(10)16-9/h1-12,21-22H;1-6,13-14H.
What are the key properties of 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol?
3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol has a molecular weight of 534.52 g/mol, XLogP of 6.56, 2 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-bis(4-hydroxyphenyl)-2-benzofuran-1-one;dibenzo-p-dioxin-1,7-diol is sourced from PubChem (CID 160841492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).