C20H16O4 — CID 91185250
3-(4-hydroxyphenyl)-3-(4-oxocyclohexen-1-yl)-2-benzofuran-1-one (PubChem CID 91185250) has the molecular formula C20H16O4 and a molecular weight of 320.34 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-3-(4-oxocyclohexen-1-yl)-2-benzofuran-1-one.
| Compound Name | 3-(4-hydroxyphenyl)-3-(4-oxocyclohexen-1-yl)-2-benzofuran-1-one |
|---|---|
| PubChem CID | 91185250 |
| Molecular Formula | C20H16O4 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 3-(4-hydroxyphenyl)-3-(4-oxocyclohexen-1-yl)-2-benzofuran-1-one |
| SMILES | O=C1CC=C(C2(c3ccc(O)cc3)OC(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C20H16O4/c21-15-9-5-13(6-10-15)20(14-7-11-16(22)12-8-14)18-4-2-1-3-17(18)19(23)24-20/h1-7,9-10,21H,8,11-12H2 |
| InChIKey | SHHIZMKPRXUWRX-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|