C28H20O7P- — CID 5256778
5-oxido-3,3,8,8-tetraphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione (PubChem CID 5256778) has the molecular formula C28H20O7P- and a molecular weight of 499.44 g/mol. Its IUPAC name is 5-oxido-3,3,8,8-tetraphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione.
| Compound Name | 5-oxido-3,3,8,8-tetraphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione |
|---|---|
| PubChem CID | 5256778 |
| Molecular Formula | C28H20O7P- |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.10 |
| IUPAC Name | 5-oxido-3,3,8,8-tetraphenyl-1,4,6,9-tetraoxa-5λ5-phosphaspiro[4.4]nonane-2,7-dione |
| SMILES | O=C1OP2([O-])(OC(=O)C(c3ccccc3)(c3ccccc3)O2)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H20O7P/c29-25-27(21-13-5-1-6-14-21,22-15-7-2-8-16-22)34-36(31,32-25)33-26(30)28(35-36,23-17-9-3-10-18-23)24-19-11-4-12-20-24/h1-20H/q-1 |
| InChIKey | CLZPLNJRSQHHIT-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 94.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|