C18H13BO4 — CID 170652411
2-(furan-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one (PubChem CID 170652411) has the molecular formula C18H13BO4 and a molecular weight of 304.11 g/mol. Its IUPAC name is 2-(furan-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one.
| Compound Name | 2-(furan-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one |
|---|---|
| PubChem CID | 170652411 |
| Molecular Formula | C18H13BO4 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2-(furan-2-yl)-5,5-diphenyl-1,3,2-dioxaborolan-4-one |
| SMILES | O=C1OB(c2ccco2)OC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H13BO4/c20-17-18(14-8-3-1-4-9-14,15-10-5-2-6-11-15)23-19(22-17)16-12-7-13-21-16/h1-13H |
| InChIKey | LYGGSNOFJRPPDO-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|