About 4-methyl-3,3-diphenyloxetan-2-one
4-methyl-3,3-diphenyloxetan-2-one (PubChem CID 87128562) has the molecular formula C16H14O2
and a molecular weight of 238.29 g/mol. Its IUPAC name is 4-methyl-3,3-diphenyloxetan-2-one.
Molecular Properties
| Compound Name | 4-methyl-3,3-diphenyloxetan-2-one |
| PubChem CID | 87128562 |
| Molecular Formula | C16H14O2 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-methyl-3,3-diphenyloxetan-2-one |
| SMILES | CC1OC(=O)C1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C16H14O2/c1-12-16(15(17)18-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,1H3 |
| InChIKey | ZCTVGIUKGVCLLW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'four_member_lactones', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-3,3-diphenyloxetan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-3,3-diphenyloxetan-2-one?
The IUPAC name of 4-methyl-3,3-diphenyloxetan-2-one (CID 87128562) is 4-methyl-3,3-diphenyloxetan-2-one.
What is the SMILES notation for 4-methyl-3,3-diphenyloxetan-2-one?
The canonical SMILES for 4-methyl-3,3-diphenyloxetan-2-one is CC1OC(=O)C1(c1ccccc1)c1ccccc1.
What is the InChIKey of 4-methyl-3,3-diphenyloxetan-2-one?
The InChIKey is ZCTVGIUKGVCLLW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O2/c1-12-16(15(17)18-12,13-8-4-2-5-9-13)14-10-6-3-7-11-14/h2-12H,1H3.
What are the key properties of 4-methyl-3,3-diphenyloxetan-2-one?
4-methyl-3,3-diphenyloxetan-2-one has a molecular weight of 238.29 g/mol, XLogP of 2.92, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-3,3-diphenyloxetan-2-one is sourced from PubChem (CID 87128562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).